C31H47NO3 — CID 88951567
(1R,2R,5S,10S,11R,12S,14R,15R,23R)-12-hydroxy-1,2,8,8,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-diene-5-carbaldehyde (PubChem CID 88951567) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is (1R,2R,5S,10S,11R,12S,14R,15R,23R)-12-hydroxy-1,2,8,8,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-diene-5-carbaldehyde.
| Compound Name | (1R,2R,5S,10S,11R,12S,14R,15R,23R)-12-hydroxy-1,2,8,8,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-diene-5-carbaldehyde |
|---|---|
| PubChem CID | 88951567 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | (1R,2R,5S,10S,11R,12S,14R,15R,23R)-12-hydroxy-1,2,8,8,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-diene-5-carbaldehyde |
| SMILES | CC1(C)CC[C@]2(C=O)CC[C@]3(C)[C@H]([C@@H](O)C[C@@H]4[C@@]5(C)Cc6cnoc6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C31H47NO3/c1-26(2)10-12-31(18-33)13-11-30(7)24(20(31)16-26)21(34)14-23-28(5)15-19-17-32-35-25(19)27(3,4)22(28)8-9-29(23,30)6/h17-18,20-24,34H,8-16H2,1-7H3/t20-,21-,22-,23+,24-,28-,29+,30+,31+/m0/s1 |
| InChIKey | ZQRIQOIGDSQBTC-NXYPCDNBSA-N |
| XLogP | 6.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|