C32H50O5 — CID 89429224
2-[(4aR,6aR,6aR,6bR,8aR,11Z,12aR,14R)-14-hydroxy-11-(hydroxymethylidene)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,3,4,5,6,6a,7,8,8a,12,13,14,14a,14b-tetradecahydropicen-4a-yl]acetic acid (PubChem CID 89429224) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2-[(4aR,6aR,6aR,6bR,8aR,11Z,12aR,14R)-14-hydroxy-11-(hydroxymethylidene)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,3,4,5,6,6a,7,8,8a,12,13,14,14a,14b-tetradecahydropicen-4a-yl]acetic acid.
| Compound Name | 2-[(4aR,6aR,6aR,6bR,8aR,11Z,12aR,14R)-14-hydroxy-11-(hydroxymethylidene)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,3,4,5,6,6a,7,8,8a,12,13,14,14a,14b-tetradecahydropicen-4a-yl]acetic acid |
|---|---|
| PubChem CID | 89429224 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2-[(4aR,6aR,6aR,6bR,8aR,11Z,12aR,14R)-14-hydroxy-11-(hydroxymethylidene)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,3,4,5,6,6a,7,8,8a,12,13,14,14a,14b-tetradecahydropicen-4a-yl]acetic acid |
| SMILES | CC1(C)CC[C@]2(CC(=O)O)CC[C@]3(C)C(C(O)C[C@@H]4[C@@]5(C)C/C(=C/O)C(=O)C(C)(C)[C@@H]5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C32H50O5/c1-27(2)10-12-32(17-24(35)36)13-11-31(7)25(20(32)16-27)21(34)14-23-29(5)15-19(18-33)26(37)28(3,4)22(29)8-9-30(23,31)6/h18,20-23,25,33-34H,8-17H2,1-7H3,(H,35,36)/b19-18-/t20?,21?,22-,23+,25?,29-,30+,31+,32+/m0/s1 |
| InChIKey | KVOMDGXYLLQANB-IJVCJNQTSA-N |
| XLogP | 6.93 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|