C31H48O4 — CID 163688236
(2E,4aR,6aR,6bR,12aS,14aR,14bR)-8a-hydroxy-2-(hydroxymethylidene)-4,4,6a,6b,11,11,12a,14b-octamethyl-1,4a,5,6,6a,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione (PubChem CID 163688236) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is (2E,4aR,6aR,6bR,12aS,14aR,14bR)-8a-hydroxy-2-(hydroxymethylidene)-4,4,6a,6b,11,11,12a,14b-octamethyl-1,4a,5,6,6a,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione.
| Compound Name | (2E,4aR,6aR,6bR,12aS,14aR,14bR)-8a-hydroxy-2-(hydroxymethylidene)-4,4,6a,6b,11,11,12a,14b-octamethyl-1,4a,5,6,6a,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 163688236 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (2E,4aR,6aR,6bR,12aS,14aR,14bR)-8a-hydroxy-2-(hydroxymethylidene)-4,4,6a,6b,11,11,12a,14b-octamethyl-1,4a,5,6,6a,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione |
| SMILES | CC1(C)CCC2(O)CC[C@]3(C)C(C(=O)C[C@@H]4[C@@]5(C)C/C(=C\O)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@]2(C)C1 |
| InChI | InChI=1S/C31H48O4/c1-25(2)11-13-31(35)14-12-29(7)23(30(31,8)18-25)20(33)15-22-27(5)16-19(17-32)24(34)26(3,4)21(27)9-10-28(22,29)6/h17,21-23,32,35H,9-16,18H2,1-8H3/b19-17+/t21-,22+,23?,27-,28+,29+,30-,31?/m0/s1 |
| InChIKey | JQSOBMOUNBCSQY-SOMVORPISA-N |
| XLogP | 6.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|