C29H44I2O3 — CID 143880849
(6bS)-8a-hydroxy-6a,12a-diiodo-4,4,6a,6b,11,11,14b-heptamethyl-1,2,4a,5,6,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione (PubChem CID 143880849) has the molecular formula C29H44I2O3 and a molecular weight of 694.48 g/mol. Its IUPAC name is (6bS)-8a-hydroxy-6a,12a-diiodo-4,4,6a,6b,11,11,14b-heptamethyl-1,2,4a,5,6,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione.
| Compound Name | (6bS)-8a-hydroxy-6a,12a-diiodo-4,4,6a,6b,11,11,14b-heptamethyl-1,2,4a,5,6,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 143880849 |
| Molecular Formula | C29H44I2O3 |
| Molecular Weight | 694.48 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | (6bS)-8a-hydroxy-6a,12a-diiodo-4,4,6a,6b,11,11,14b-heptamethyl-1,2,4a,5,6,7,8,9,10,12,14,14a-dodecahydropicene-3,13-dione |
| SMILES | CC1(C)CCC2(O)CC[C@@]3(C)C4(C)CCC5C(C)(C)C(=O)CCC5(C)C4CC(=O)C3(I)C2(I)C1 |
| InChI | InChI=1S/C29H44I2O3/c1-22(2)12-14-27(34)15-13-26(7)25(6)11-8-18-23(3,4)20(32)9-10-24(18,5)19(25)16-21(33)29(26,31)28(27,30)17-22/h18-19,34H,8-17H2,1-7H3/t18?,19?,24?,25?,26-,27?,28?,29?/m0/s1 |
| InChIKey | GALXHMAJZSMXNN-VOIBAXKLSA-N |
| XLogP | 7.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.48 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|