C30H50O2 — CID 162978165
6b-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-one (PubChem CID 162978165) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 6b-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-one.
| Compound Name | 6b-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-one |
|---|---|
| PubChem CID | 162978165 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 6b-hydroxy-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-one |
| SMILES | CC1(C)CCC2(C)CCC3(O)C(C)(CCC4C5(C)CCC(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C30H50O2/c1-24(2)15-16-26(5)17-18-30(32)28(7)13-9-20-25(3,4)23(31)11-12-27(20,6)21(28)10-14-29(30,8)22(26)19-24/h20-22,32H,9-19H2,1-8H3 |
| InChIKey | JRNQXVISLVHREP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |