C30H46O3 — CID 177494488
(4aR,6aR,6aR,6bR,8aR,12aR)-2,2,4a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14-dodecahydro-1H-picene-6a-carboxylic acid (PubChem CID 177494488) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aR,12aR)-2,2,4a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14-dodecahydro-1H-picene-6a-carboxylic acid.
| Compound Name | (4aR,6aR,6aR,6bR,8aR,12aR)-2,2,4a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14-dodecahydro-1H-picene-6a-carboxylic acid |
|---|---|
| PubChem CID | 177494488 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aR,12aR)-2,2,4a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14-dodecahydro-1H-picene-6a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C)CC[C@]3(C(=O)O)C(=C2C1)CC[C@@H]1[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC[C@]13C |
| InChI | InChI=1S/C30H46O3/c1-25(2)14-15-27(5)16-17-30(24(32)33)19(20(27)18-25)8-9-22-28(6)12-11-23(31)26(3,4)21(28)10-13-29(22,30)7/h21-22H,8-18H2,1-7H3,(H,32,33)/t21-,22+,27+,28-,29+,30+/m0/s1 |
| InChIKey | RUFATYUXSPKCOC-KWSLMVSGSA-N |
| XLogP | 7.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|