C32H47NO2 — CID 163617127
(4aR,6aR,6aR,6bR,12aS,14aR,14bR)-8a-ethenyl-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile (PubChem CID 163617127) has the molecular formula C32H47NO2 and a molecular weight of 477.73 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,12aS,14aR,14bR)-8a-ethenyl-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile.
| Compound Name | (4aR,6aR,6aR,6bR,12aS,14aR,14bR)-8a-ethenyl-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 163617127 |
| Molecular Formula | C32H47NO2 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | (4aR,6aR,6aR,6bR,12aS,14aR,14bR)-8a-ethenyl-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile |
| SMILES | C=CC12CCC(C)(C)C[C@H]1[C@H]1C(=O)C[C@@H]3[C@@]4(C)CC(C#N)=C(O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H47NO2/c1-9-32-14-12-27(2,3)18-21(32)25-22(34)16-24-29(6)17-20(19-33)26(35)28(4,5)23(29)10-11-30(24,7)31(25,8)13-15-32/h9,21,23-25,35H,1,10-18H2,2-8H3/t21-,23-,24+,25-,29-,30+,31+,32?/m0/s1 |
| InChIKey | HKYDQAYCSNJZJN-AJBPDFQGSA-N |
| XLogP | 8.18 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|