C32H49NO4 — CID 143880852
(6bR)-8a-(1,2-dihydroxyethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile (PubChem CID 143880852) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is (6bR)-8a-(1,2-dihydroxyethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile.
| Compound Name | (6bR)-8a-(1,2-dihydroxyethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 143880852 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | (6bR)-8a-(1,2-dihydroxyethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picene-2-carbonitrile |
| SMILES | CC1(C)CCC2(C(O)CO)CC[C@]3(C)C(C(=O)CC4C5(C)CC(C#N)=C(O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C32H49NO4/c1-27(2)10-12-32(24(36)18-34)13-11-31(7)25(20(32)16-27)21(35)14-23-29(5)15-19(17-33)26(37)28(3,4)22(29)8-9-30(23,31)6/h20,22-25,34,36-37H,8-16,18H2,1-7H3/t20?,22?,23?,24?,25?,29?,30?,31-,32?/m1/s1 |
| InChIKey | YJYGDGZWNLXHQT-RCSSSSOWSA-N |
| XLogP | 6.35 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |