C31H47NO2 — CID 66710133
(6aR,6aR,6bR,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-3,13-dioxo-1,2,4a,5,6,6a,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile (PubChem CID 66710133) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (6aR,6aR,6bR,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-3,13-dioxo-1,2,4a,5,6,6a,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile.
| Compound Name | (6aR,6aR,6bR,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-3,13-dioxo-1,2,4a,5,6,6a,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 66710133 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (6aR,6aR,6bR,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-3,13-dioxo-1,2,4a,5,6,6a,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(C)CC[C@]3(C)[C@H](C(=O)C[C@@H]4[C@@]5(C)CC(C#N)C(=O)C(C)(C)C5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C31H47NO2/c1-26(2)11-12-28(5)13-14-31(8)24(20(28)17-26)21(33)15-23-29(6)16-19(18-32)25(34)27(3,4)22(29)9-10-30(23,31)7/h19-20,22-24H,9-17H2,1-8H3/t19?,20-,22?,23-,24+,28-,29+,30-,31-/m1/s1 |
| InChIKey | PLGABJGSPDKHOG-VLCQWAKNSA-N |
| XLogP | 7.39 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|