C31H45NO3 — CID 162014329
(1R,2R,5R,10S,11R,14S,15R,16R,18R,21R)-18-isocyano-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-12,19-dione (PubChem CID 162014329) has the molecular formula C31H45NO3 and a molecular weight of 479.71 g/mol. Its IUPAC name is (1R,2R,5R,10S,11R,14S,15R,16R,18R,21R)-18-isocyano-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-12,19-dione.
| Compound Name | (1R,2R,5R,10S,11R,14S,15R,16R,18R,21R)-18-isocyano-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-12,19-dione |
|---|---|
| PubChem CID | 162014329 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (1R,2R,5R,10S,11R,14S,15R,16R,18R,21R)-18-isocyano-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-12,19-dione |
| SMILES | [C-]#[N+][C@@]12O[C@@H]1[C@]1(C)[C@H]3CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]1C(C)(C)C2=O |
| InChI | InChI=1S/C31H45NO3/c1-25(2)12-13-27(5)14-15-29(7)22(18(27)17-25)19(33)16-21-28(29,6)11-10-20-26(3,4)23(34)31(32-9)24(35-31)30(20,21)8/h18,20-22,24H,10-17H2,1-8H3/t18-,20-,21-,22-,24+,27+,28+,29+,30-,31-/m0/s1 |
| InChIKey | RMUBKRZYSNLGOB-LLWBWQIDSA-N |
| XLogP | 6.87 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|