C34H51NO2 — CID 58456527
(4aR,6aR,6aR,6bR,8aR,12aS,14aR,14bR)-8a-butyl-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione (PubChem CID 58456527) has the molecular formula C34H51NO2 and a molecular weight of 505.79 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aR,12aS,14aR,14bR)-8a-butyl-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione.
| Compound Name | (4aR,6aR,6aR,6bR,8aR,12aS,14aR,14bR)-8a-butyl-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 58456527 |
| Molecular Formula | C34H51NO2 |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 505.39 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aR,12aS,14aR,14bR)-8a-butyl-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(CCCC)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C34H51NO2/c1-10-11-13-34-17-15-29(2,3)20-22(34)27-24(36)19-26-31(6)21-23(35-9)28(37)30(4,5)25(31)12-14-32(26,7)33(27,8)16-18-34/h21-22,25-27H,10-20H2,1-8H3/t22-,25-,26+,27-,31-,32+,33+,34+/m0/s1 |
| InChIKey | GEJOPONDZKGLDW-ATDRKCKUSA-N |
| XLogP | 8.83 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|