C31H45NO2Y-2 — CID 58456564
(4aR,6aR,6bR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicen-8a-ide-3,13-dione;carbanide;yttrium (PubChem CID 58456564) has the molecular formula C31H45NO2Y-2 and a molecular weight of 552.61 g/mol. Its IUPAC name is (4aR,6aR,6bR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicen-8a-ide-3,13-dione;carbanide;yttrium.
| Compound Name | (4aR,6aR,6bR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicen-8a-ide-3,13-dione;carbanide;yttrium |
|---|---|
| PubChem CID | 58456564 |
| Molecular Formula | C31H45NO2Y-2 |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (4aR,6aR,6bR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicen-8a-ide-3,13-dione;carbanide;yttrium |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3CC(=O)C4C5CC(C)(C)CC[C-]5CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O.[CH3-].[Y] |
| InChI | InChI=1S/C30H42NO2.CH3.Y/c1-26(2)12-9-18-10-13-30(7)24(19(18)16-26)21(32)15-23-28(5)17-20(31-8)25(33)27(3,4)22(28)11-14-29(23,30)6;;/h17,19,22-24H,9-16H2,1-7H3;1H3;/q2*-1;/t19?,22-,23?,24?,28-,29+,30+;;/m0../s1 |
| InChIKey | PKUNXNFPLZBILS-QHNYFKGTSA-N |
| XLogP | 7.67 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|