C31H43NO3 — CID 58456477
(1S,4S,5R,8R,13R,14R,17S,18R)-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-10,16-dione (PubChem CID 58456477) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is (1S,4S,5R,8R,13R,14R,17S,18R)-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-10,16-dione.
| Compound Name | (1S,4S,5R,8R,13R,14R,17S,18R)-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-10,16-dione |
|---|---|
| PubChem CID | 58456477 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | (1S,4S,5R,8R,13R,14R,17S,18R)-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-10,16-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3CC(=O)[C@]45OC[C@@]6(CCC(C)(C)C[C@H]64)CC[C@@]5(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C31H43NO3/c1-25(2)11-13-30-14-12-29(7)28(6)10-9-20-26(3,4)24(34)19(32-8)16-27(20,5)21(28)15-23(33)31(29,35-18-30)22(30)17-25/h16,20-22H,9-15,17-18H2,1-7H3/t20-,21+,22+,27-,28+,29-,30+,31+/m0/s1 |
| InChIKey | CTLILTGLOZIMOI-SWZIUVRYSA-N |
| XLogP | 6.79 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|