C33H49NO4 — CID 159483655
ethyl (4aS,6aR,6aR,6bR,8aR,12aR,14R,14aR,14bS)-14-hydroxy-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,13,14,14a,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 159483655) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is ethyl (4aS,6aR,6aR,6bR,8aR,12aR,14R,14aR,14bS)-14-hydroxy-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,13,14,14a,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | ethyl (4aS,6aR,6aR,6bR,8aR,12aR,14R,14aR,14bS)-14-hydroxy-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,13,14,14a,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 159483655 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | ethyl (4aS,6aR,6aR,6bR,8aR,12aR,14R,14aR,14bS)-14-hydroxy-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,13,14,14a,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3C[C@@H](O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)OCC)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C33H49NO4/c1-10-38-27(37)33-15-13-28(2,3)18-20(33)25-22(35)17-24-30(6)19-21(34-9)26(36)29(4,5)23(30)11-12-31(24,7)32(25,8)14-16-33/h19-20,22-25,35H,10-18H2,1-8H3/t20-,22+,23-,24+,25-,30-,31+,32+,33-/m0/s1 |
| InChIKey | WDYOCAHQIARTRY-UDWIVYQVSA-N |
| XLogP | 6.99 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|