C33H49NO4S — CID 58456548
(6aR,6aR,6bR,8aR,12aS,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylsulfonylethyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione (PubChem CID 58456548) has the molecular formula C33H49NO4S and a molecular weight of 555.83 g/mol. Its IUPAC name is (6aR,6aR,6bR,8aR,12aS,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylsulfonylethyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione.
| Compound Name | (6aR,6aR,6bR,8aR,12aS,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylsulfonylethyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 58456548 |
| Molecular Formula | C33H49NO4S |
| Molecular Weight | 555.83 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | (6aR,6aR,6bR,8aR,12aS,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylsulfonylethyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)C(CC[C@]3(C)[C@@H]2CC(=O)[C@@H]2[C@@H]4CC(C)(C)CC[C@]4(CCS(C)(=O)=O)CC[C@]23C)C(C)(C)C1=O |
| InChI | InChI=1S/C33H49NO4S/c1-28(2)12-14-33(16-17-39(9,37)38)15-13-32(7)26(21(33)19-28)23(35)18-25-30(5)20-22(34-8)27(36)29(3,4)24(30)10-11-31(25,32)6/h20-21,24-26H,10-19H2,1-7,9H3/t21-,24?,25+,26-,30-,31+,32+,33+/m0/s1 |
| InChIKey | GVSAZTQDWAARIW-WQXKFHIZSA-N |
| XLogP | 7.07 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|