C32H43F3N2O3 — CID 59203276
N-[(4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicen-4a-yl]-2,2,2-trifluoroacetamide (PubChem CID 59203276) has the molecular formula C32H43F3N2O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-[(4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicen-4a-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicen-4a-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59203276 |
| Molecular Formula | C32H43F3N2O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | N-[(4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicen-4a-yl]-2,2,2-trifluoroacetamide |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(NC(=O)C(F)(F)F)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H43F3N2O3/c1-26(2)11-13-31(37-25(40)32(33,34)35)14-12-30(7)23(18(31)16-26)20(38)15-22-28(5)17-19(36-8)24(39)27(3,4)21(28)9-10-29(22,30)6/h17-18,21-23H,9-16H2,1-7H3,(H,37,40)/t18-,21-,22+,23-,28-,29+,30+,31-/m0/s1 |
| InChIKey | KZQZFEONQLEHFO-TYBNQPICSA-N |
| XLogP | 7.07 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|