C32H45NO5 — CID 90068518
methyl (1R,2R,5S,14S,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-5-carboxylate (PubChem CID 90068518) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is methyl (1R,2R,5S,14S,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-5-carboxylate.
| Compound Name | methyl (1R,2R,5S,14S,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-5-carboxylate |
|---|---|
| PubChem CID | 90068518 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | methyl (1R,2R,5S,14S,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosane-5-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1C(=O)C[C@@H]3[C@@]4(C)[C@H]5O[C@@]5(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H45NO5/c1-26(2)11-13-31(25(36)37-8)14-12-29(6)22(18(31)16-26)19(34)15-21-28(29,5)10-9-20-27(3,4)23(35)32(17-33)24(38-32)30(20,21)7/h18,20-22,24H,9-16H2,1-8H3/t18?,20-,21-,22?,24+,28+,29+,30-,31-,32-/m0/s1 |
| InChIKey | XNTQAGZLCULYIE-QKUHEODXSA-N |
| XLogP | 5.67 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|