C32H46N2O4 — CID 87200343
N-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicene-4a-carboxamide (PubChem CID 87200343) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is N-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicene-4a-carboxamide.
| Compound Name | N-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 87200343 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | N-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydropicene-4a-carboxamide |
| SMILES | CON(C#N)C(=O)C12CCC(C)(C)CC1C1C(=O)CC3C4(C)C=CC(=O)C(C)(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C32H46N2O4/c1-27(2)13-15-32(26(37)34(19-33)38-8)16-14-31(7)25(20(32)18-27)21(35)17-23-29(5)11-10-24(36)28(3,4)22(29)9-12-30(23,31)6/h10-11,20,22-23,25H,9,12-18H2,1-8H3 |
| InChIKey | NPGRVSQUYNZXKP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|