C32H45NO6 — CID 118100052
methyl (1S,2R,5S,10S,11R,15S,16R,18R,21R)-18-carbamoyl-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxylate (PubChem CID 118100052) has the molecular formula C32H45NO6 and a molecular weight of 539.71 g/mol. Its IUPAC name is methyl (1S,2R,5S,10S,11R,15S,16R,18R,21R)-18-carbamoyl-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxylate.
| Compound Name | methyl (1S,2R,5S,10S,11R,15S,16R,18R,21R)-18-carbamoyl-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxylate |
|---|---|
| PubChem CID | 118100052 |
| Molecular Formula | C32H45NO6 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | methyl (1S,2R,5S,10S,11R,15S,16R,18R,21R)-18-carbamoyl-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@]4(C)[C@@H](CC[C@@]3(C)[C@]1(C)CC2)C(C)(C)C(=O)[C@]1(C(N)=O)O[C@@H]14 |
| InChI | InChI=1S/C32H45NO6/c1-26(2)11-13-31(25(37)38-8)14-12-29(6)21(17(31)16-26)18(34)15-20-28(29,5)10-9-19-27(3,4)22(35)32(24(33)36)23(39-32)30(19,20)7/h15,17,19,21,23H,9-14,16H2,1-8H3,(H2,33,36)/t17-,19-,21-,23+,28+,29+,30-,31-,32-/m0/s1 |
| InChIKey | IFZMTFXQBBKACA-SNMNGPBQSA-N |
| XLogP | 4.55 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|