C23H39NO2 — CID 142351133
(3S,8R,10R,14R,17R)-17-amino-3-hydroxy-4,4,8,10,14,17-hexamethyl-2,3,5,6,7,9,11,13,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-one (PubChem CID 142351133) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (3S,8R,10R,14R,17R)-17-amino-3-hydroxy-4,4,8,10,14,17-hexamethyl-2,3,5,6,7,9,11,13,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-one.
| Compound Name | (3S,8R,10R,14R,17R)-17-amino-3-hydroxy-4,4,8,10,14,17-hexamethyl-2,3,5,6,7,9,11,13,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-one |
|---|---|
| PubChem CID | 142351133 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (3S,8R,10R,14R,17R)-17-amino-3-hydroxy-4,4,8,10,14,17-hexamethyl-2,3,5,6,7,9,11,13,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-one |
| SMILES | CC1(C)C2CC[C@]3(C)C(CC(=O)C4[C@](C)(N)CC[C@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C23H39NO2/c1-19(2)15-7-10-21(4)16(20(15,3)9-8-17(19)26)13-14(25)18-22(21,5)11-12-23(18,6)24/h15-18,26H,7-13,24H2,1-6H3/t15?,16?,17-,18?,20-,21+,22+,23+/m0/s1 |
| InChIKey | CIBHXPYLSDJWRB-CZSFHSEHSA-N |
| XLogP | 4.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |