C22H30O4 — CID 170924427
(3S,5R,8R,9R,10S,14R)-3-hydroxy-4,4,8,10,14-pentamethyl-1,2,3,5,6,7,9,13-octahydrocyclopenta[a]phenanthrene-15,16,17-trione (PubChem CID 170924427) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3S,5R,8R,9R,10S,14R)-3-hydroxy-4,4,8,10,14-pentamethyl-1,2,3,5,6,7,9,13-octahydrocyclopenta[a]phenanthrene-15,16,17-trione.
| Compound Name | (3S,5R,8R,9R,10S,14R)-3-hydroxy-4,4,8,10,14-pentamethyl-1,2,3,5,6,7,9,13-octahydrocyclopenta[a]phenanthrene-15,16,17-trione |
|---|---|
| PubChem CID | 170924427 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3S,5R,8R,9R,10S,14R)-3-hydroxy-4,4,8,10,14-pentamethyl-1,2,3,5,6,7,9,13-octahydrocyclopenta[a]phenanthrene-15,16,17-trione |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3C=CC4C(=O)C(=O)C(=O)[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H30O4/c1-19(2)13-8-11-21(4)14(20(13,3)10-9-15(19)23)7-6-12-16(24)17(25)18(26)22(12,21)5/h6-7,12-15,23H,8-11H2,1-5H3/t12?,13-,14+,15-,20-,21+,22-/m0/s1 |
| InChIKey | YLLYAVQQOIIIIT-VKKCVJFQSA-N |
| XLogP | 3.12 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|