C18H30O2 — CID 135009606
(4aR,4bS,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-one (PubChem CID 135009606) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (4aR,4bS,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-one.
| Compound Name | (4aR,4bS,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-one |
|---|---|
| PubChem CID | 135009606 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (4aR,4bS,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-one |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3CCCC(=O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C18H30O2/c1-16(2)12-8-10-18(4)13(6-5-7-15(18)20)17(12,3)11-9-14(16)19/h12-14,19H,5-11H2,1-4H3/t12-,13+,14-,17-,18+/m0/s1 |
| InChIKey | AWXQNOPJARYCRO-BKZBBRBJSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |