C26H38O4 — CID 163112224
4-hydroxy-3-[(7-hydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-1-yl)methyl]-6-methylpyran-2-one (PubChem CID 163112224) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-hydroxy-3-[(7-hydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-1-yl)methyl]-6-methylpyran-2-one.
| Compound Name | 4-hydroxy-3-[(7-hydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-1-yl)methyl]-6-methylpyran-2-one |
|---|---|
| PubChem CID | 163112224 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 4-hydroxy-3-[(7-hydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-1-yl)methyl]-6-methylpyran-2-one |
| SMILES | CC1=C(Cc2c(O)cc(C)oc2=O)C2(C)CCC3C(C)(C)C(O)CCC3(C)C2CC1 |
| InChI | InChI=1S/C26H38O4/c1-15-7-8-21-25(5,18(15)14-17-19(27)13-16(2)30-23(17)29)11-9-20-24(3,4)22(28)10-12-26(20,21)6/h13,20-22,27-28H,7-12,14H2,1-6H3 |
| InChIKey | PGQIYFXKLHRAJW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|