C29H42O5 — CID 163016078
[(2S,4aR,8R,8aS)-8-[(4-methoxy-6-methyl-2-oxopyran-3-yl)methyl]-1,1,4a,8a-tetramethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-2-yl] acetate (PubChem CID 163016078) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [(2S,4aR,8R,8aS)-8-[(4-methoxy-6-methyl-2-oxopyran-3-yl)methyl]-1,1,4a,8a-tetramethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-2-yl] acetate.
| Compound Name | [(2S,4aR,8R,8aS)-8-[(4-methoxy-6-methyl-2-oxopyran-3-yl)methyl]-1,1,4a,8a-tetramethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 163016078 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(2S,4aR,8R,8aS)-8-[(4-methoxy-6-methyl-2-oxopyran-3-yl)methyl]-1,1,4a,8a-tetramethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-2-yl] acetate |
| SMILES | C=C1CCC2[C@@]3(C)CC[C@H](OC(C)=O)C(C)(C)C3CC[C@@]2(C)[C@@H]1Cc1c(OC)cc(C)oc1=O |
| InChI | InChI=1S/C29H42O5/c1-17-9-10-24-28(6,21(17)16-20-22(32-8)15-18(2)33-26(20)31)13-11-23-27(4,5)25(34-19(3)30)12-14-29(23,24)7/h15,21,23-25H,1,9-14,16H2,2-8H3/t21-,23?,24?,25+,28+,29+/m1/s1 |
| InChIKey | SWPMQTFNOVDXPL-MCXQUKNKSA-N |
| XLogP | 6.26 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|