C23H34O3 — CID 11451205
(2S,4aR,5S,8aR)-5-[(2,5-dimethoxyphenyl)methyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11451205) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (2S,4aR,5S,8aR)-5-[(2,5-dimethoxyphenyl)methyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5S,8aR)-5-[(2,5-dimethoxyphenyl)methyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11451205 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (2S,4aR,5S,8aR)-5-[(2,5-dimethoxyphenyl)methyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@H]1Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H34O3/c1-15-7-10-20-22(2,3)21(24)11-12-23(20,4)18(15)14-16-13-17(25-5)8-9-19(16)26-6/h8-9,13,18,20-21,24H,1,7,10-12,14H2,2-6H3/t18-,20-,21-,23+/m0/s1 |
| InChIKey | CSVVPLPYFDKXDI-XHRGMSINSA-N |
| XLogP | 5.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|