C27H39NO3 — CID 154635125
(E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-(3-methoxyphenyl)-3-methylpent-2-enamide (PubChem CID 154635125) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-(3-methoxyphenyl)-3-methylpent-2-enamide.
| Compound Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-(3-methoxyphenyl)-3-methylpent-2-enamide |
|---|---|
| PubChem CID | 154635125 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-(3-methoxyphenyl)-3-methylpent-2-enamide |
| SMILES | C=C1CC[C@@H]2C(C)(C)[C@H](O)CC[C@@]2(C)[C@@H]1CC/C(C)=C/C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C27H39NO3/c1-18(16-25(30)28-20-8-7-9-21(17-20)31-6)10-12-22-19(2)11-13-23-26(3,4)24(29)14-15-27(22,23)5/h7-9,16-17,22-24,29H,2,10-15H2,1,3-6H3,(H,28,30)/b18-16+/t22-,23-,24-,27+/m1/s1 |
| InChIKey | HJWHIRXRKFXBGI-CHMSLGFGSA-N |
| XLogP | 6.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|