C31H48O5 — CID 72817771
2-(5-formyloxy-3-methylpent-3-enyl)-6-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl]-1-methyl-3-methylidenecyclohexane-1-carboxylic acid (PubChem CID 72817771) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is 2-(5-formyloxy-3-methylpent-3-enyl)-6-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl]-1-methyl-3-methylidenecyclohexane-1-carboxylic acid.
| Compound Name | 2-(5-formyloxy-3-methylpent-3-enyl)-6-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl]-1-methyl-3-methylidenecyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 72817771 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 2-(5-formyloxy-3-methylpent-3-enyl)-6-[(6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl]-1-methyl-3-methylidenecyclohexane-1-carboxylic acid |
| SMILES | C=C1CCC2C(C)(C)C(O)CCC2(C)C1CC1CCC(=C)C(CCC(C)=CCOC=O)C1(C)C(=O)O |
| InChI | InChI=1S/C31H48O5/c1-20(15-17-36-19-32)8-12-24-21(2)9-11-23(31(24,7)28(34)35)18-25-22(3)10-13-26-29(4,5)27(33)14-16-30(25,26)6/h15,19,23-27,33H,2-3,8-14,16-18H2,1,4-7H3,(H,34,35) |
| InChIKey | XEUKKEGFRHPDSJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|