C21H30O — CID 11220259
(2S,4aR,5S,8aR)-5-benzyl-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11220259) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (2S,4aR,5S,8aR)-5-benzyl-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5S,8aR)-5-benzyl-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11220259 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2S,4aR,5S,8aR)-5-benzyl-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H30O/c1-15-10-11-18-20(2,3)19(22)12-13-21(18,4)17(15)14-16-8-6-5-7-9-16/h5-9,17-19,22H,1,10-14H2,2-4H3/t17-,18-,19-,21+/m0/s1 |
| InChIKey | KAGFGRSCBYPFQJ-VNYTWHDVSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|