C23H33IO2 — CID 11691272
(1R,2S,4aR,5S,8aR)-5-(2-iodoethyl)-1,4a-dimethyl-6-methylidene-1-(phenylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11691272) has the molecular formula C23H33IO2 and a molecular weight of 468.42 g/mol. Its IUPAC name is (1R,2S,4aR,5S,8aR)-5-(2-iodoethyl)-1,4a-dimethyl-6-methylidene-1-(phenylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (1R,2S,4aR,5S,8aR)-5-(2-iodoethyl)-1,4a-dimethyl-6-methylidene-1-(phenylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11691272 |
| Molecular Formula | C23H33IO2 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (1R,2S,4aR,5S,8aR)-5-(2-iodoethyl)-1,4a-dimethyl-6-methylidene-1-(phenylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@H]2[C@](C)(COCc3ccccc3)[C@@H](O)CC[C@]2(C)[C@H]1CCI |
| InChI | InChI=1S/C23H33IO2/c1-17-9-10-20-22(2,19(17)12-14-24)13-11-21(25)23(20,3)16-26-15-18-7-5-4-6-8-18/h4-8,19-21,25H,1,9-16H2,2-3H3/t19-,20+,21-,22+,23-/m0/s1 |
| InChIKey | XTNVRTLUAWXHEI-BFRACDOUSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|