C27H33NO6 — CID 118736294
[(1R,2R,4aS,5R,8aS)-5-[2-(furan-3-yl)ethyl]-2-hydroxy-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 4-nitrobenzoate (PubChem CID 118736294) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8aS)-5-[2-(furan-3-yl)ethyl]-2-hydroxy-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 4-nitrobenzoate.
| Compound Name | [(1R,2R,4aS,5R,8aS)-5-[2-(furan-3-yl)ethyl]-2-hydroxy-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 118736294 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [(1R,2R,4aS,5R,8aS)-5-[2-(furan-3-yl)ethyl]-2-hydroxy-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 4-nitrobenzoate |
| SMILES | C=C1CC[C@@H]2[C@](C)(COC(=O)c3ccc([N+](=O)[O-])cc3)[C@H](O)CC[C@@]2(C)[C@@H]1CCc1ccoc1 |
| InChI | InChI=1S/C27H33NO6/c1-18-4-11-23-26(2,22(18)10-5-19-13-15-33-16-19)14-12-24(29)27(23,3)17-34-25(30)20-6-8-21(9-7-20)28(31)32/h6-9,13,15-16,22-24,29H,1,4-5,10-12,14,17H2,2-3H3/t22-,23+,24-,26+,27+/m1/s1 |
| InChIKey | UKCRHEXLKBTEPU-MUAUJTQOSA-N |
| XLogP | 5.73 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|