C35H42O2 — CID 11488798
(4aR,8R,8aR)-8-[[2,5-bis(phenylmethoxy)phenyl]methyl]-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene (PubChem CID 11488798) has the molecular formula C35H42O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is (4aR,8R,8aR)-8-[[2,5-bis(phenylmethoxy)phenyl]methyl]-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene.
| Compound Name | (4aR,8R,8aR)-8-[[2,5-bis(phenylmethoxy)phenyl]methyl]-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 11488798 |
| Molecular Formula | C35H42O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | (4aR,8R,8aR)-8-[[2,5-bis(phenylmethoxy)phenyl]methyl]-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
| SMILES | C=C1CC[C@@H]2C(C)(C)CCC[C@@]2(C)[C@@H]1Cc1cc(OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H42O2/c1-26-16-19-33-34(2,3)20-11-21-35(33,4)31(26)23-29-22-30(36-24-27-12-7-5-8-13-27)17-18-32(29)37-25-28-14-9-6-10-15-28/h5-10,12-15,17-18,22,31,33H,1,11,16,19-21,23-25H2,2-4H3/t31-,33-,35+/m1/s1 |
| InChIKey | GAWPTIYKDHIHPJ-LLMATUJJSA-N |
| XLogP | 9.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|