C33H36O3 — CID 56926963
(4aS,5S,6S,8aR)-5-[[2,5-bis(phenylmethoxy)phenyl]methyl]-5,6-dimethyl-2,3,4,4a,6,8a-hexahydronaphthalen-1-one (PubChem CID 56926963) has the molecular formula C33H36O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is (4aS,5S,6S,8aR)-5-[[2,5-bis(phenylmethoxy)phenyl]methyl]-5,6-dimethyl-2,3,4,4a,6,8a-hexahydronaphthalen-1-one.
| Compound Name | (4aS,5S,6S,8aR)-5-[[2,5-bis(phenylmethoxy)phenyl]methyl]-5,6-dimethyl-2,3,4,4a,6,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 56926963 |
| Molecular Formula | C33H36O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (4aS,5S,6S,8aR)-5-[[2,5-bis(phenylmethoxy)phenyl]methyl]-5,6-dimethyl-2,3,4,4a,6,8a-hexahydronaphthalen-1-one |
| SMILES | C[C@H]1C=C[C@H]2C(=O)CCC[C@@H]2[C@@]1(C)Cc1cc(OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H36O3/c1-24-16-18-29-30(14-9-15-31(29)34)33(24,2)21-27-20-28(35-22-25-10-5-3-6-11-25)17-19-32(27)36-23-26-12-7-4-8-13-26/h3-8,10-13,16-20,24,29-30H,9,14-15,21-23H2,1-2H3/t24-,29+,30-,33-/m0/s1 |
| InChIKey | GJXQGWNCIUORQC-MJHJNNAXSA-N |
| XLogP | 7.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|