C41H46O3Se — CID 11006871
(6aS,12aR,12bS)-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene (PubChem CID 11006871) has the molecular formula C41H46O3Se and a molecular weight of 665.78 g/mol. Its IUPAC name is (6aS,12aR,12bS)-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene.
| Compound Name | (6aS,12aR,12bS)-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene |
|---|---|
| PubChem CID | 11006871 |
| Molecular Formula | C41H46O3Se |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | (6aS,12aR,12bS)-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene |
| SMILES | CC1(C)CCC[C@@]2(C)C1CC[C@]1(C[Se]c3ccccc3)Oc3cc(OCc4ccccc4)c(OCc4ccccc4)cc3C[C@@H]12 |
| InChI | InChI=1S/C41H46O3Se/c1-39(2)21-13-22-40(3)37(39)20-23-41(29-45-33-18-11-6-12-19-33)38(40)25-32-24-35(42-27-30-14-7-4-8-15-30)36(26-34(32)44-41)43-28-31-16-9-5-10-17-31/h4-12,14-19,24,26,37-38H,13,20-23,25,27-29H2,1-3H3/t37?,38-,40+,41-/m1/s1 |
| InChIKey | HEONXCDKVCJRBJ-STCULTOMSA-N |
| XLogP | 9.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|