C41H45ClO4Se — CID 11285534
(4aS,6aS,12aS,12bS)-11-chloro-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-ol (PubChem CID 11285534) has the molecular formula C41H45ClO4Se and a molecular weight of 716.22 g/mol. Its IUPAC name is (4aS,6aS,12aS,12bS)-11-chloro-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-ol.
| Compound Name | (4aS,6aS,12aS,12bS)-11-chloro-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-ol |
|---|---|
| PubChem CID | 11285534 |
| Molecular Formula | C41H45ClO4Se |
| Molecular Weight | 716.22 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | (4aS,6aS,12aS,12bS)-11-chloro-4,4,12b-trimethyl-9,10-bis(phenylmethoxy)-6a-(phenylselanylmethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-ol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@]1(C[Se]c3ccccc3)Oc3cc(OCc4ccccc4)c(OCc4ccccc4)c(Cl)c3C(O)[C@@H]12 |
| InChI | InChI=1S/C41H45ClO4Se/c1-39(2)21-13-22-40(3)33(39)20-23-41(27-47-30-18-11-6-12-19-30)38(40)36(43)34-31(46-41)24-32(44-25-28-14-7-4-8-15-28)37(35(34)42)45-26-29-16-9-5-10-17-29/h4-12,14-19,24,33,36,38,43H,13,20-23,25-27H2,1-3H3/t33-,36?,38+,40-,41+/m0/s1 |
| InChIKey | JVCKPWZLFYOKEP-MBJIDRTLSA-N |
| XLogP | 9.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.22 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|