C23H33NO5 — CID 10811171
(4aS,6aS,12S,12aR,12bS)-4,4,6a,12b-tetramethyl-12-(1-nitroethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol (PubChem CID 10811171) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (4aS,6aS,12S,12aR,12bS)-4,4,6a,12b-tetramethyl-12-(1-nitroethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol.
| Compound Name | (4aS,6aS,12S,12aR,12bS)-4,4,6a,12b-tetramethyl-12-(1-nitroethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol |
|---|---|
| PubChem CID | 10811171 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (4aS,6aS,12S,12aR,12bS)-4,4,6a,12b-tetramethyl-12-(1-nitroethyl)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol |
| SMILES | CC([C@@H]1c2cc(O)c(O)cc2O[C@@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@@H]12)[N+](=O)[O-] |
| InChI | InChI=1S/C23H33NO5/c1-13(24(27)28)19-14-11-15(25)16(26)12-17(14)29-23(5)10-7-18-21(2,3)8-6-9-22(18,4)20(19)23/h11-13,18-20,25-26H,6-10H2,1-5H3/t13?,18-,19+,20+,22-,23-/m0/s1 |
| InChIKey | DPLTWIIWGUWAQN-PIELJVDNSA-N |
| XLogP | 5.24 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|