C21H29ClO3 — CID 10021720
(4aS,6aS,12aR,12bS)-11-chloro-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol (PubChem CID 10021720) has the molecular formula C21H29ClO3 and a molecular weight of 364.91 g/mol. Its IUPAC name is (4aS,6aS,12aR,12bS)-11-chloro-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol.
| Compound Name | (4aS,6aS,12aR,12bS)-11-chloro-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol |
|---|---|
| PubChem CID | 10021720 |
| Molecular Formula | C21H29ClO3 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4aS,6aS,12aR,12bS)-11-chloro-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-9,10-diol |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3Cc4c(cc(O)c(O)c4Cl)O[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H29ClO3/c1-19(2)7-5-8-20(3)15(19)6-9-21(4)16(20)10-12-14(25-21)11-13(23)18(24)17(12)22/h11,15-16,23-24H,5-10H2,1-4H3/t15-,16+,20-,21-/m0/s1 |
| InChIKey | BJHNCPSFXMOPPY-GQSCTRQFSA-N |
| XLogP | 5.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|