C23H34O2 — CID 76800032
9-methoxy-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-10-ol (PubChem CID 76800032) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 9-methoxy-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-10-ol.
| Compound Name | 9-methoxy-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-10-ol |
|---|---|
| PubChem CID | 76800032 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 9-methoxy-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-10-ol |
| SMILES | COc1cc(C)c2c(c1O)CC1C2(C)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C23H34O2/c1-14-12-16(25-6)20(24)15-13-18-22(4)10-7-9-21(2,3)17(22)8-11-23(18,5)19(14)15/h12,17-18,24H,7-11,13H2,1-6H3 |
| InChIKey | BGAOLDODFWWQBN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |