C26H39NO2 — CID 89007052
[(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-aminobutanoate (PubChem CID 89007052) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-aminobutanoate.
| Compound Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-aminobutanoate |
|---|---|
| PubChem CID | 89007052 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-aminobutanoate |
| SMILES | CCC(N)C(=O)Oc1cc(C)c2c(c1)C[C@H]1C2(C)CCC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C26H39NO2/c1-7-19(27)23(28)29-18-13-16(2)22-17(14-18)15-21-25(5)11-8-10-24(3,4)20(25)9-12-26(21,22)6/h13-14,19-21H,7-12,15,27H2,1-6H3/t19?,20?,21-,25+,26?/m1/s1 |
| InChIKey | SYNMSCWEEHHWPY-KFNIWJMWSA-N |
| XLogP | 5.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|