C25H37NO6P — CID 59624219
CID 59624219 (PubChem CID 59624219) has the molecular formula C25H37NO6P and a molecular weight of 478.55 g/mol.
| Compound Name | CID 59624219 |
|---|---|
| PubChem CID | 59624219 |
| Molecular Formula | C25H37NO6P |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | — |
| SMILES | Cc1cc(OC(=O)C(N)[CH]OP(=O)(O)O)cc2c1C1(C)CCC3C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C25H37NO6P/c1-15-11-17(32-22(27)18(26)14-31-33(28,29)30)12-16-13-20-24(4)9-6-8-23(2,3)19(24)7-10-25(20,5)21(15)16/h11-12,14,18-20H,6-10,13,26H2,1-5H3,(H2,28,29,30)/t18?,19?,20-,24+,25?/m1/s1 |
| InChIKey | UBMDCPPPUPFHCY-ATZUBJETSA-N |
| XLogP | 4.56 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|