C25H37O2PS — CID 143597194
[(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-methylphosphanylsulfanylacetate (PubChem CID 143597194) has the molecular formula C25H37O2PS and a molecular weight of 432.61 g/mol. Its IUPAC name is [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-methylphosphanylsulfanylacetate.
| Compound Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-methylphosphanylsulfanylacetate |
|---|---|
| PubChem CID | 143597194 |
| Molecular Formula | C25H37O2PS |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-methylphosphanylsulfanylacetate |
| SMILES | CPSCC(=O)Oc1cc(C)c2c(c1)C[C@H]1C2(C)CCC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C25H37O2PS/c1-16-12-18(27-21(26)15-29-28-6)13-17-14-20-24(4)10-7-9-23(2,3)19(24)8-11-25(20,5)22(16)17/h12-13,19-20,28H,7-11,14-15H2,1-6H3/t19?,20-,24+,25?/m1/s1 |
| InChIKey | OWGVHCOIIOIGDE-SDLFKWCXSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|