C26H37NO4 — CID 58482760
4-[[(6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-amino-4-oxobutanoic acid (PubChem CID 58482760) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[[(6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-amino-4-oxobutanoic acid.
| Compound Name | 4-[[(6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58482760 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-[[(6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-amino-4-oxobutanoic acid |
| SMILES | Cc1cc(OC(=O)C(N)CC(=O)O)cc2c1[C@]1(C)CCC3C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C26H37NO4/c1-15-11-17(31-23(30)18(27)14-21(28)29)12-16-13-20-25(4)9-6-8-24(2,3)19(25)7-10-26(20,5)22(15)16/h11-12,18-20H,6-10,13-14,27H2,1-5H3,(H,28,29)/t18?,19?,20-,25+,26-/m1/s1 |
| InChIKey | WDJXZTULYMZESR-SHBWOMCYSA-N |
| XLogP | 4.76 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|