C23H34OS — CID 75987508
8-methoxy-1,1,4a,10,10b-pentamethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene (PubChem CID 75987508) has the molecular formula C23H34OS and a molecular weight of 358.59 g/mol. Its IUPAC name is 8-methoxy-1,1,4a,10,10b-pentamethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene.
| Compound Name | 8-methoxy-1,1,4a,10,10b-pentamethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene |
|---|---|
| PubChem CID | 75987508 |
| Molecular Formula | C23H34OS |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 8-methoxy-1,1,4a,10,10b-pentamethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene |
| SMILES | COc1cc(C)c2c(c1)SCC1C2(C)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C23H34OS/c1-15-12-16(24-6)13-17-20(15)23(5)11-8-18-21(2,3)9-7-10-22(18,4)19(23)14-25-17/h12-13,18-19H,7-11,14H2,1-6H3 |
| InChIKey | KLIFWCSSLRCATA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |