C17H16O4 — CID 101352862
(1aS,2S,7R,7aR)-3-phenylmethoxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxirene-2,7-diol (PubChem CID 101352862) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (1aS,2S,7R,7aR)-3-phenylmethoxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxirene-2,7-diol.
| Compound Name | (1aS,2S,7R,7aR)-3-phenylmethoxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxirene-2,7-diol |
|---|---|
| PubChem CID | 101352862 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (1aS,2S,7R,7aR)-3-phenylmethoxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxirene-2,7-diol |
| SMILES | O[C@@H]1c2cccc(OCc3ccccc3)c2[C@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C17H16O4/c18-14-11-7-4-8-12(13(11)15(19)17-16(14)21-17)20-9-10-5-2-1-3-6-10/h1-8,14-19H,9H2/t14-,15+,16-,17+/m1/s1 |
| InChIKey | PAQGTPQSMMFRLA-TWMKSMIVSA-N |
| XLogP | 2.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|