C17H18O2 — CID 102424590
8-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 102424590) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 8-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 8-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 102424590 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 8-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | OC1CCc2cccc(OCc3ccccc3)c2C1 |
| InChI | InChI=1S/C17H18O2/c18-15-10-9-14-7-4-8-17(16(14)11-15)19-12-13-5-2-1-3-6-13/h1-8,15,18H,9-12H2 |
| InChIKey | FPOSZNKEJDYMHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |