C21H29ClO3 — CID 71697145
(3aR,4S,5R,7aR)-4-[(2-chloro-3,5-dimethoxyphenyl)methyl]-4,7a-dimethyl-1-methylidene-2,3,3a,5,6,7-hexahydroinden-5-ol (PubChem CID 71697145) has the molecular formula C21H29ClO3 and a molecular weight of 364.91 g/mol. Its IUPAC name is (3aR,4S,5R,7aR)-4-[(2-chloro-3,5-dimethoxyphenyl)methyl]-4,7a-dimethyl-1-methylidene-2,3,3a,5,6,7-hexahydroinden-5-ol.
| Compound Name | (3aR,4S,5R,7aR)-4-[(2-chloro-3,5-dimethoxyphenyl)methyl]-4,7a-dimethyl-1-methylidene-2,3,3a,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 71697145 |
| Molecular Formula | C21H29ClO3 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3aR,4S,5R,7aR)-4-[(2-chloro-3,5-dimethoxyphenyl)methyl]-4,7a-dimethyl-1-methylidene-2,3,3a,5,6,7-hexahydroinden-5-ol |
| SMILES | C=C1CC[C@H]2[C@](C)(Cc3cc(OC)cc(OC)c3Cl)[C@H](O)CC[C@@]12C |
| InChI | InChI=1S/C21H29ClO3/c1-13-6-7-17-20(13,2)9-8-18(23)21(17,3)12-14-10-15(24-4)11-16(25-5)19(14)22/h10-11,17-18,23H,1,6-9,12H2,2-5H3/t17-,18-,20+,21+/m1/s1 |
| InChIKey | FUBPKMUZOLXPNE-QCFAMHMHSA-N |
| XLogP | 5.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|