C22H30O6S — CID 102080254
[2-[[(1S,2S,4aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-4-formyl-6-hydroxyphenyl] hydrogen sulfate (PubChem CID 102080254) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is [2-[[(1S,2S,4aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-4-formyl-6-hydroxyphenyl] hydrogen sulfate.
| Compound Name | [2-[[(1S,2S,4aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-4-formyl-6-hydroxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 102080254 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-[[(1S,2S,4aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-4-formyl-6-hydroxyphenyl] hydrogen sulfate |
| SMILES | C=C1CCCC2[C@]1(C)CC[C@H](C)[C@]2(C)Cc1cc(C=O)cc(O)c1OS(=O)(=O)O |
| InChI | InChI=1S/C22H30O6S/c1-14-6-5-7-19-21(14,3)9-8-15(2)22(19,4)12-17-10-16(13-23)11-18(24)20(17)28-29(25,26)27/h10-11,13,15,19,24H,1,5-9,12H2,2-4H3,(H,25,26,27)/t15-,19?,21+,22-/m0/s1 |
| InChIKey | HEFPFRHSKUYNLS-QANXQLDVSA-N |
| XLogP | 4.73 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|