C22H32O3 — CID 15275969
(4aS,5R,6R,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 15275969) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (4aS,5R,6R,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5R,6R,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 15275969 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (4aS,5R,6R,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | COc1ccc(OC)c(C[C@]2(C)[C@H](C)CC[C@]3(C)C(=O)CCC[C@@H]23)c1 |
| InChI | InChI=1S/C22H32O3/c1-15-11-12-21(2)19(7-6-8-20(21)23)22(15,3)14-16-13-17(24-4)9-10-18(16)25-5/h9-10,13,15,19H,6-8,11-12,14H2,1-5H3/t15-,19-,21+,22-/m1/s1 |
| InChIKey | RJOQSNKLSLXHIN-SPPOGVHBSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |