C25H36O4 — CID 124895438
[3-[[(1R,2R,4aR,5R,8aR)-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methyl]-4-acetyloxyphenyl] acetate (PubChem CID 124895438) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [3-[[(1R,2R,4aR,5R,8aR)-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methyl]-4-acetyloxyphenyl] acetate.
| Compound Name | [3-[[(1R,2R,4aR,5R,8aR)-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methyl]-4-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 124895438 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [3-[[(1R,2R,4aR,5R,8aR)-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methyl]-4-acetyloxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c(C[C@@]2(C)[C@@H]3CCC[C@@H](C)[C@@]3(C)CC[C@H]2C)c1 |
| InChI | InChI=1S/C25H36O4/c1-16-8-7-9-23-24(16,5)13-12-17(2)25(23,6)15-20-14-21(28-18(3)26)10-11-22(20)29-19(4)27/h10-11,14,16-17,23H,7-9,12-13,15H2,1-6H3/t16-,17-,23-,24-,25-/m1/s1 |
| InChIKey | JNPCOXQSZZCMMB-LGDYHXFWSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|