C23H36O3 — CID 23252174
(1R,4aS,5R,6S,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol (PubChem CID 23252174) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1R,4aS,5R,6S,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol.
| Compound Name | (1R,4aS,5R,6S,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 23252174 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1R,4aS,5R,6S,8aS)-5-[(2,5-dimethoxyphenyl)methyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol |
| SMILES | COc1ccc(OC)c(C[C@]2(C)[C@@H](C)CC[C@@]3(C)[C@H]2CCC[C@@]3(C)O)c1 |
| InChI | InChI=1S/C23H36O3/c1-16-11-13-22(3)20(8-7-12-23(22,4)24)21(16,2)15-17-14-18(25-5)9-10-19(17)26-6/h9-10,14,16,20,24H,7-8,11-13,15H2,1-6H3/t16-,20-,21+,22-,23+/m0/s1 |
| InChIKey | SIGASJOLWKUBCJ-MJZWAZDZSA-N |
| XLogP | 5.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |