C14H20O3 — CID 65049668
1-(2,5-dimethoxyphenyl)-2-methylcyclopentan-1-ol (PubChem CID 65049668) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-methylcyclopentan-1-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65049668 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-methylcyclopentan-1-ol |
| SMILES | COc1ccc(OC)c(C2(O)CCCC2C)c1 |
| InChI | InChI=1S/C14H20O3/c1-10-5-4-8-14(10,15)12-9-11(16-2)6-7-13(12)17-3/h6-7,9-10,15H,4-5,8H2,1-3H3 |
| InChIKey | KINSNJKNIGHQQX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |